Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2126 | Purity: >98% |
 | |
| Chemical structure of PD318088 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 391210-00-7 |
|---|---|
| Purity | >98% |
| Formula | C16H13BrF3IN2O4 |
| Mol Weight | 561.089 |
| CoA | CoA of PD318088 |
| Smiles: | OCC(O)CONC(=O)C1=C(NC2=CC=C(I)C=C2F)C(F)=C(F)C(Br)=C1 |
|---|
KEYWORDS: buy PD318088 | PD318088 supplier | purchase | cost | manufacturer | order | distributor | buy 391210-00-7 | 391210-00-7 supplier