Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A808 | Purity: >98% |
 | |
| Chemical structure of PD168393 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 194423-15-9 |
|---|---|
| Purity | >98% |
| Formula | C17H13BrN4O |
| Mol Weight | 369.215 |
| CoA | CoA of PD168393 |
| Smiles: | BrC1=CC(NC2=C3C=C(NC(=O)C=C)C=CC3=NC=N2)=CC=C1 |
|---|
KEYWORDS: buy PD168393 | PD168393 supplier | purchase | cost | manufacturer | order | distributor | buy 194423-15-9 | 194423-15-9 supplier