Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2124 | Purity: >98% |
 | |
| Chemical structure of PD151746 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 179461-52-0 |
|---|---|
| Purity | >98% |
| Formula | C11H8FNO2S |
| Mol Weight | 237.25 |
| CoA | CoA of PD151746 |
| Smiles: | OC(=O)C(\S)=C\C1=CNC2=C1C=C(F)C=C2 |
|---|
KEYWORDS: buy PD151746 | PD151746 supplier | purchase | cost | manufacturer | order | distributor | buy 179461-52-0 | 179461-52-0 supplier