Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A025 | Purity: >98% |
 | |
| Chemical structure of PD0332991 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 827022-32-2 |
|---|---|
| Purity | >98% |
| Formula | C24H30ClN7O2 |
| Mol Weight | 483.994 |
| CoA | CoA of PD0332991 |
| Smiles: | Cl.CC(=O)C1=C(C)C2=CN=C(NC3=NC=C(C=C3)N3CCNCC3)N=C2N(C2CCCC2)C1=O |
|---|
KEYWORDS: buy PD0332991 | PD0332991 supplier | purchase | cost | manufacturer | order | distributor | buy 827022-32-2 | 827022-32-2 supplier