Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4966 | Purity: >98% |
 | |
| Chemical structure of PCNA-I1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | PCNA I1 |
|---|---|
| Synonyms 2 | N-[(1-hydroxynaphthalen-2-yl)methylideneamino]-3-methylthiophene-2-carboxamide |
| CAS No. | 444930-42-1 |
| Purity | >98% |
| Formula | C17H14N2O2S |
| Mol Weight | 310.37 |
| CoA | CoA of PCNA-I1 |
| Smiles: | CC1=C(SC=C1)C(=O)NN=CC2=C(C3=CC=CC=C3C=C2)O |
|---|
KEYWORDS: buy PCNA-I1 | PCNA-I1 supplier | purchase | cost | manufacturer | order | distributor | buy 444930-42-1 | 444930-42-1 supplier