Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A930 | Purity: >98% |
 | |
| Chemical structure of PCI-34051 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 950762-95-5 |
|---|---|
| Purity | >98% |
| Formula | C17H16N2O3 |
| Mol Weight | 296.3205 |
| CoA | CoA of PCI-34051 |
| Smiles: | COC1=CC=C(CN2C=CC3=C2C=C(C=C3)C(=O)NO)C=C1 |
|---|
KEYWORDS: buy PCI-34051 | PCI-34051 supplier | purchase | cost | manufacturer | order | distributor | buy 950762-95-5 | 950762-95-5 supplier