Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A066 | Purity: >99% |
 | |
| Chemical structure of PCI-32765 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 936563-96-1 |
|---|---|
| Purity | >99% |
| Formula | C25H24N6O2 |
| Mol Weight | 440.4971 |
| CoA | CoA of PCI-32765 |
| Smiles: | NC1=C2C(=NC=N1)N(N=C2C1=CC=C(OC2=CC=CC=C2)C=C1)[C@@H]1CCCN(C1)C(=O)C=C |
|---|
KEYWORDS: buy PCI-32765 | PCI-32765 supplier | purchase | cost | manufacturer | order | distributor | buy 936563-96-1 | 936563-96-1 supplier