Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11519 | Purity: >98% |
 | |
| Chemical structure of PCB 103 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | PCB No.103 |
|---|---|
| CAS No. | 60145-21-3 |
| Purity | >98% |
| Formula | C12H5Cl5 |
| Mol Weight | 326.433 |
| CoA | CoA of PCB 103 |
| Smiles: | ClC1=CC=C(Cl)C(=C1)C=2C(Cl)=CC(Cl)=CC2Cl |
|---|
KEYWORDS: buy PCB 103 | PCB 103 supplier | purchase | cost | manufacturer | order | distributor | buy 60145-21-3 | 60145-21-3 supplier