Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1241 | Purity: >98% |
 | |
| Chemical structure of Pazopanib |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 444731-52-6 |
|---|---|
| Purity | >98% |
| Formula | C21H23N7O2S |
| Mol Weight | 437.518 |
| CoA | CoA of Pazopanib |
| Smiles: | CN(C1=CC2=NN(C)C(C)=C2C=C1)C1=NC(NC2=CC=C(C)C(=C2)S(N)(=O)=O)=NC=C1 |
|---|
KEYWORDS: buy Pazopanib | Pazopanib supplier | purchase | cost | manufacturer | order | distributor | buy 444731-52-6 | 444731-52-6 supplier