Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16808 | Purity: >98% |
 | |
| Chemical structure of PARP1 inhibitor |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2921728-30-3 |
|---|---|
| Purity | >98% |
| Formula | C22H22ClN5O3 |
| Mol Weight | 439.895 |
| CoA | CoA of PARP1 inhibitor |
| Smiles: | C(N1[C@H](C)[C@@H](OC=2C=CC(C(NC3CC3)=O)=NC2)C1)C=4C=C5C(=NC4)C=C(Cl)C(=O)N5 |
|---|
KEYWORDS: buy PARP1 inhibitor | PARP1 inhibitor supplier | purchase | cost | manufacturer | order | distributor | buy 2921728-30-3 | 2921728-30-3 supplier