Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A624 | Purity: >98% |
 | |
| Chemical structure of Pardoprunox |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 269718-84-5 |
|---|---|
| Purity | >98% |
| Formula | C12H15N3O2 |
| Mol Weight | 233.2664 |
| CoA | CoA of Pardoprunox |
| Smiles: | CN1CCN(CC1)C1=C2OC(=O)NC2=CC=C1 |
|---|
KEYWORDS: buy Pardoprunox | Pardoprunox supplier | purchase | cost | manufacturer | order | distributor | buy 269718-84-5 | 269718-84-5 supplier