Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A17472 | Purity: >98% |
 | |
| Chemical structure of Pan-KRAS inhibitor |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2991354-61-9 |
|---|---|
| Purity | >98% |
| Formula | C35H37F3N8O3S |
| Mol Weight | 706.78 |
| CoA | CoA of Pan-KRAS inhibitor |
| Smiles: | FC=1C=2C(=C(N=C(OC[C@@]34N(C[C@H](F)C3)CCC4)N2)N5C6CN(C[C@H](C)O)CC5CC6)C7=C(C1C8=C9C(SC(N)=C9C#N)=C(F)C=N8)COC7 |
|---|
KEYWORDS: buy Pan-KRAS inhibitor | Pan-KRAS inhibitor supplier | purchase | cost | manufacturer | order | distributor | buy 2991354-61-9 | 2991354-61-9 supplier