Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11586 | Purity: >98% |
 | |
| Chemical structure of PAG904 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 915104-90-4 |
|---|---|
| Purity | >98% |
| Formula | C27H26F9N3O6S4 |
| Mol Weight | 787.757 |
| CoA | CoA of PAG904 |
| Smiles: | O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCN(C)CC1)C(F)(F)F.C=1C=CC(=CC1)[S+](C=2C=CC=CC2)C=3C=CC=CC3 |
|---|
KEYWORDS: buy PAG904 | PAG904 supplier | purchase | cost | manufacturer | order | distributor | buy 915104-90-4 | 915104-90-4 supplier