Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2122 | Purity: >98% |
 | |
| Chemical structure of PAC-1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 315183-21-2 |
|---|---|
| Purity | >98% |
| Formula | C23H28N4O2 |
| Mol Weight | 392.494 |
| CoA | CoA of PAC-1 |
| Smiles: | OC1=C(CC=C)C=CC=C1\C=N\NC(=O)CN1CCN(CC2=CC=CC=C2)CC1 |
|---|
KEYWORDS: buy PAC-1 | PAC-1 supplier | purchase | cost | manufacturer | order | distributor | buy 315183-21-2 | 315183-21-2 supplier