Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2693 | Purity: >98% |
 | |
| Chemical structure of Ozenoxacin |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | T-3912 |
|---|---|
| CAS No. | 245765-41-7 |
| Purity | >98% |
| Formula | C21H21N3O3 |
| Mol Weight | 363.4097 |
| CoA | CoA of Ozenoxacin |
| Smiles: | CNC1=C(C)C=C(C=N1)C1=C(C)C2=C(C=C1)C(=O)C(=CN2C1CC1)C(O)=O |
|---|
KEYWORDS: buy Ozenoxacin | Ozenoxacin supplier | purchase | cost | manufacturer | order | distributor | buy 245765-41-7 | 245765-41-7 supplier