Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A638 | Purity: >98% |
 | |
| Chemical structure of Ostarine |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | MK2286 |
|---|---|
| Synonyms 2 | (1202044-20-9) |
| CAS No. | 1235370-13-4 |
| Purity | >98% |
| Formula | C19H14F3N3O3 |
| Mol Weight | 389.328 |
| CoA | CoA of Ostarine |
| Smiles: | C[C@](O)(COC1=CC=C(C=C1)C#N)C(=O)NC1=CC=C(C#N)C(=C1)C(F)(F)F |
|---|
KEYWORDS: buy Ostarine | Ostarine supplier | purchase | cost | manufacturer | order | distributor | buy 1235370-13-4 | 1235370-13-4 supplier