Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3499 | Purity: >98% |
 | |
| Chemical structure of Org 24598 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 372198-97-5 |
|---|---|
| Purity | >98% |
| Formula | C19H20F3NO3 |
| Mol Weight | 367.3622 |
| CoA | CoA of Org 24598 |
| Smiles: | CN(CC[C@H](C1=CC=CC=C1)OC2=CC=C(C=C2)C(F)(F)F)CC(=O)O |
|---|
KEYWORDS: buy Org 24598 | Org 24598 supplier | purchase | cost | manufacturer | order | distributor | buy 372198-97-5 | 372198-97-5 supplier