Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A332 | Purity: >98% |
 | |
| Chemical structure of ONX-0912 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 935888-69-0 |
|---|---|
| Purity | >98% |
| Formula | C25H32N4O7S |
| Mol Weight | 532.609 |
| CoA | CoA of ONX-0912 |
| Smiles: | COC[C@H](NC(=O)[C@H](COC)NC(=O)C1=CN=C(C)S1)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)[C@@]1(C)CO1 |
|---|
KEYWORDS: buy ONX-0912 | ONX-0912 supplier | purchase | cost | manufacturer | order | distributor | buy 935888-69-0 | 935888-69-0 supplier