Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A17444 | Purity: >98% |
 | |
| Chemical structure of ONO-AE3-240 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 499150-44-6 |
|---|---|
| Purity | >98% |
| Formula | C34H33N3O3 |
| Mol Weight | 531.6441 |
| CoA | CoA of ONO-AE3-240 |
| Smiles: | O=C(O)C=1C=CC=CC1CC2=CC=C(C=C2NC(=O)C(C3=CC=CC=4C=CC=CC43)CC(C)C)CN5N=CC=C5 |
|---|
KEYWORDS: buy ONO-AE3-240 | ONO-AE3-240 supplier | purchase | cost | manufacturer | order | distributor | buy 499150-44-6 | 499150-44-6 supplier