Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1273 | Purity: >98% |
 | |
| Chemical structure of ONO-4059 analogue |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1351635-67-0 |
|---|---|
| Purity | >98% |
| Formula | C25H24N6O3 |
| Mol Weight | 456.4965 |
| CoA | CoA of ONO-4059 analogue |
| Smiles: | NC1=C2N(C(=O)N([C@H]3CCCN(C3)C(=O)C=C)C2=NC=N1)C1=CC=C(OC2=CC=CC=C2)C=C1 |
|---|
KEYWORDS: buy ONO-4059 analogue | ONO-4059 analogue supplier | purchase | cost | manufacturer | order | distributor | buy 1351635-67-0 | 1351635-67-0 supplier