Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9668 | Purity: >95% |
 | |
| Chemical structure of OncoFAP-DOTAGA |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Purity | >95% |
|---|---|
| Formula | C42H55F2N11O13 |
| Mol Weight | 959.9488 |
| CoA | CoA of OncoFAP-DOTAGA |
| Smiles: | OC(=O)CN1CCN(CC(O)=O)CCN(CCN(CC(O)=O)CC1)C(CCC(=O)NCCNC(=O)CCC(=O)NC1=C2N=CC=C(C(=O)NCC(=O)N3CC(F)(F)C[C@H]3C#N)C2=CC=C1)C(O)=O |
|---|
KEYWORDS: buy OncoFAP-DOTAGA | OncoFAP-DOTAGA supplier | purchase | cost | manufacturer | order | distributor | buy | supplier