Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1468 | Purity: >98% |
 | |
| Chemical structure of Ochratoxin-A |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1448049-50-0 |
|---|---|
| Purity | >98% |
| Formula | C20H18ClNO6 |
| Mol Weight | 407.838 |
| CoA | CoA of Ochratoxin-A |
| Smiles: | [2H]C([2H])([2H])[C@]1([2H])CC2=C(C(=O)O1)C(O)=C(C=C2Cl)C(=O)N[C@@H](CC1=CC=CC=C1)C(O)=O |
|---|
KEYWORDS: buy Ochratoxin-A | Ochratoxin-A supplier | purchase | cost | manufacturer | order | distributor | buy 1448049-50-0 | 1448049-50-0 supplier