Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A906 | Purity: >98% |
 | |
| Chemical structure of OAC2 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 6019-39-2 |
|---|---|
| Purity | >98% |
| Formula | C15H12N2O |
| Mol Weight | 236.2686 |
| CoA | CoA of OAC2 |
| Smiles: | O=C(NC1=CC2=C(NC=C2)C=C1)C1=CC=CC=C1 |
|---|
KEYWORDS: buy OAC2 | OAC2 supplier | purchase | cost | manufacturer | order | distributor | buy 6019-39-2 | 6019-39-2 supplier