Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2404 | Purity: >98% |
 | |
| Chemical structure of NXY-059 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 168021-79-2 |
|---|---|
| Purity | >98% |
| Formula | C11H13NNa2O7S2 |
| Mol Weight | 381.333 |
| CoA | CoA of NXY-059 |
| Smiles: | CC(C)(C)[N+](\[O-])=C\C1=C(C=C(C=C1)S(=O)(=O)O[Na])S(=O)(=O)O[Na] |
|---|
KEYWORDS: buy NXY-059 | NXY-059 supplier | purchase | cost | manufacturer | order | distributor | buy 168021-79-2 | 168021-79-2 supplier