Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2627 | Purity: >98% |
 | |
| Chemical structure of NVP-TNKS656 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1419949-20-4 |
|---|---|
| Purity | >98% |
| Formula | C27H34N4O5 |
| Mol Weight | 494.5827 |
| CoA | CoA of NVP-TNKS656 |
| Smiles: | COC1=CC=C(C=C1)C(=O)C1CCN(CC(=O)N(CC2CC2)CC2=NC3=C(COCC3)C(=O)N2)CC1 |
|---|
KEYWORDS: buy NVP-TNKS656 | NVP-TNKS656 supplier | purchase | cost | manufacturer | order | distributor | buy 1419949-20-4 | 1419949-20-4 supplier