Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A17437 | Purity: >98% |
 | |
| Chemical structure of NVP-KFA115 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2408998-17-2 |
|---|---|
| Purity | >98% |
| Formula | C24H31N3O5 |
| Mol Weight | 441.52 |
| CoA | CoA of NVP-KFA115 |
| Smiles: | O=C1N(CC=2C1=CC=C(O[C@@H]3[C@H](CCCC3)N4CC(OCC)C4)C2)C5C(=O)NC(=O)CC5 |
|---|
KEYWORDS: buy NVP-KFA115 | NVP-KFA115 supplier | purchase | cost | manufacturer | order | distributor | buy 2408998-17-2 | 2408998-17-2 supplier