Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1059 | Purity: >98% |
 | |
| Chemical structure of NVP-CGM097 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1313363-54-0 |
|---|---|
| Purity | >98% |
| Formula | C38H47ClN4O4 |
| Mol Weight | 659.257 |
| CoA | CoA of NVP-CGM097 |
| Smiles: | COC1=CC2=C(C=C1OC(C)C)[C@@H](N(C(=O)C2)C1=CC=C(C=C1)N(C)CC1CCC(CC1)N1CCN(C)C(=O)C1)C1=CC=C(Cl)C=C1 |
|---|
KEYWORDS: buy NVP-CGM097 | NVP-CGM097 supplier | purchase | cost | manufacturer | order | distributor | buy 1313363-54-0 | 1313363-54-0 supplier