Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A277 | Purity: >99% |
 | |
| Chemical structure of NSI-189 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1270138-40-3 |
|---|---|
| Purity | >99% |
| Formula | C22H30N4O |
| Mol Weight | 366.4998 |
| CoA | CoA of NSI-189 |
| Smiles: | CC(C)CCNC1=NC=CC=C1C(=O)N1CCN(CC2=CC=CC=C2)CC1 |
|---|
KEYWORDS: buy NSI-189 | NSI-189 supplier | purchase | cost | manufacturer | order | distributor | buy 1270138-40-3 | 1270138-40-3 supplier