Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A14757 | Purity: >98% |
 | |
| Chemical structure of NSC 80538 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 370-26-3 |
|---|---|
| Purity | >98% |
| Formula | C13H10ClFN2S |
| Mol Weight | 280.748 |
| CoA | CoA of NSC 80538 |
| Smiles: | C1=CC(=CC=C1NC(=S)NC2=CC=C(C=C2)Cl)F |
|---|
KEYWORDS: buy NSC 80538 | NSC 80538 supplier | purchase | cost | manufacturer | order | distributor | buy 370-26-3 | 370-26-3 supplier