Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A342 | Purity: >98% |
 | |
| Chemical structure of NSC 74859 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | S3I-201 |
|---|---|
| CAS No. | 501919-59-1 |
| Purity | >98% |
| Formula | C16H15NO7S |
| Mol Weight | 365.358 |
| CoA | CoA of NSC 74859 |
| Smiles: | CC1=CC=C(C=C1)S(=O)(=O)OCC(=O)NC1=CC=C(C(O)=O)C(O)=C1 |
|---|
KEYWORDS: buy NSC 74859 | NSC 74859 supplier | purchase | cost | manufacturer | order | distributor | buy 501919-59-1 | 501919-59-1 supplier