Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A138 | Purity: >98% |
 | |
| Chemical structure of NSC 652287 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | RITA |
|---|---|
| CAS No. | 213261-59-7 |
| Purity | >98% |
| Formula | C14H12O3S2 |
| Mol Weight | 292.373 |
| CoA | CoA of NSC 652287 |
| Smiles: | OCC1=CC=C(S1)C1=CC=C(O1)C1=CC=C(CO)S1 |
|---|
KEYWORDS: buy NSC 652287 | NSC 652287 supplier | purchase | cost | manufacturer | order | distributor | buy 213261-59-7 | 213261-59-7 supplier