Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A124 | Purity: >98% |
 | |
| Chemical structure of NSC 42834 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | JAK2 Inhibitor V Z3 |
|---|---|
| CAS No. | 195371-52-9 |
| Purity | >98% |
| Formula | C23H24N2O |
| Mol Weight | 344.4495 |
| CoA | CoA of NSC 42834 |
| Smiles: | CC(CCC1=NC=CC=C1)(CCC1=NC=CC=C1)C(=O)C1=CC=CC=C1 |
|---|
KEYWORDS: buy NSC 42834 | NSC 42834 supplier | purchase | cost | manufacturer | order | distributor | buy 195371-52-9 | 195371-52-9 supplier