Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2403 | Purity: >98% |
 | |
| Chemical structure of NSC 23766 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | NSC 23766 tetrahydrochloride |
|---|---|
| CAS No. | 733767-34-5 |
| Purity | >98% |
| Formula | C24H35N7 |
| Mol Weight | 421.5816 |
| CoA | CoA of NSC 23766 |
| Smiles: | CCN(CC)CCCC(C)NC1=NC(C)=CC(NC2=CC=C3N=C(C)C=C(N)C3=C2)=N1 |
|---|
KEYWORDS: buy NSC 23766 | NSC 23766 supplier | purchase | cost | manufacturer | order | distributor | buy 733767-34-5 | 733767-34-5 supplier