Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3518 | Purity: >98% |
 | |
| Chemical structure of NS6740 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 753499-14-8 |
|---|---|
| Purity | >98% |
| Formula | C19H20ClF3N2O2 |
| Mol Weight | 400.823 |
| CoA | CoA of NS6740 |
| Smiles: | C1CN2CCC1N(CC2)C(=O)C3=CC=C(O3)C4=CC(=CC=C4)C(F)(F)F.Cl |
|---|
KEYWORDS: buy NS6740 | NS6740 supplier | purchase | cost | manufacturer | order | distributor | buy 753499-14-8 | 753499-14-8 supplier