Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A744 | Purity: >98% |
 | |
| Chemical structure of NS 11021 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 956014-19-0 |
|---|---|
| Purity | >98% |
| Formula | C16H9BrF6N6S |
| Mol Weight | 511.242 |
| CoA | CoA of NS 11021 |
| Smiles: | FC(F)(F)C1=CC(NC(=S)NC2=CC=C(Br)C=C2C2=NNN=N2)=CC(=C1)C(F)(F)F |
|---|
KEYWORDS: buy NS 11021 | NS 11021 supplier | purchase | cost | manufacturer | order | distributor | buy 956014-19-0 | 956014-19-0 supplier