Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A820 | Purity: >98% |
 | |
| Chemical structure of NQDI-1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 175026-96-7 |
|---|---|
| Purity | >98% |
| Formula | C19H13NO4 |
| Mol Weight | 319.3108 |
| CoA | CoA of NQDI-1 |
| Smiles: | CCOC(=O)C1=C2C3=CC=CC=C3C(=O)C3=C2C(NC1=O)=CC=C3 |
|---|
KEYWORDS: buy NQDI-1 | NQDI-1 supplier | purchase | cost | manufacturer | order | distributor | buy 175026-96-7 | 175026-96-7 supplier