Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9690M | Purity: >98% |
 | |
| Chemical structure of NOTA-PNP |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1402571-17-8 |
|---|---|
| Purity | >98% |
| Formula | C18H24N4O8 |
| Mol Weight | 424.4052 |
| CoA | CoA of NOTA-PNP |
| Smiles: | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)OC2=CC=C(C=C2)N(=O)=O)CC1 |
|---|
KEYWORDS: buy NOTA-PNP | NOTA-PNP supplier | purchase | cost | manufacturer | order | distributor | buy 1402571-17-8 | 1402571-17-8 supplier