Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3993 | Purity: >98% |
 | |
| Chemical structure of Nomifensine maleate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | (+/-)-Nomifensine maleate |
|---|---|
| CAS No. | 32795-47-4 |
| Purity | >98% |
| Formula | C20H22N2O4 |
| Mol Weight | 354.3997 |
| CoA | CoA of Nomifensine maleate |
| Smiles: | NC1=CC=CC2=C1CN(C)CC2C3=CC=CC=C3.O=C(O)/C=C\C(O)=O |
|---|
KEYWORDS: buy Nomifensine maleate | Nomifensine maleate supplier | purchase | cost | manufacturer | order | distributor | buy 32795-47-4 | 32795-47-4 supplier