Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2112 | Purity: >98% |
 | |
| Chemical structure of Nolatrexed dihydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | AG-337 |
|---|---|
| CAS No. | 152946-68-4 |
| Purity | >98% |
| Formula | C14H14Cl2N4OS |
| Mol Weight | 357.258 |
| CoA | CoA of Nolatrexed dihydrochloride |
| Smiles: | Cl.Cl.CC1=C(SC2=CC=NC=C2)C2=C(NC(N)=NC2=O)C=C1 |
|---|
KEYWORDS: buy Nolatrexed dihydrochloride | Nolatrexed dihydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 152946-68-4 | 152946-68-4 supplier