Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2111 | Purity: >98% |
 | |
| Chemical structure of NMS-P715 analog |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1202055-34-2 |
|---|---|
| Purity | >98% |
| Formula | C35H42N8O3 |
| Mol Weight | 622.7598 |
| CoA | CoA of NMS-P715 analog |
| Smiles: | CCC1=CC=CC(CC)=C1NC(=O)C1=NN(C)C2=C1CCC1=CN=C(NC3=C(OC)C=C(C=C3)C(=O)NC3CCN(C)CC3)N=C21 |
|---|
KEYWORDS: buy NMS-P715 analog | NMS-P715 analog supplier | purchase | cost | manufacturer | order | distributor | buy 1202055-34-2 | 1202055-34-2 supplier