Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3534 | Purity: >99% |
 | |
| Chemical structure of NMN |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1094-61-7 |
|---|---|
| Purity | >99% |
| Formula | C11H15N2O8P |
| Mol Weight | 334.2192 |
| CoA | CoA of NMN |
| Smiles: | NC(C1=C[N+]([C@@H]2O[C@H](COP(O)([O-])=O)[C@@H](O)[C@H]2O)=CC=C1)=O |
|---|
KEYWORDS: buy NMN | NMN supplier | purchase | cost | manufacturer | order | distributor | buy 1094-61-7 | 1094-61-7 supplier