Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A062 | Purity: >98% |
 | |
| Chemical structure of Neratinib |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | HKI-272 |
|---|---|
| CAS No. | 698387-09-6 |
| Purity | >98% |
| Formula | C30H29ClN6O3 |
| Mol Weight | 557.043 |
| CoA | CoA of Neratinib |
| Smiles: | CCOC1=C(NC(=O)\C=C\CN(C)C)C=C2C(=C1)N=CC(C#N)=C2NC1=CC=C(OCC2=NC=CC=C2)C(Cl)=C1 |
|---|
KEYWORDS: buy Neratinib | Neratinib supplier | purchase | cost | manufacturer | order | distributor | buy 698387-09-6 | 698387-09-6 supplier