Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10112 | Purity: >98% |
 | |
| Chemical structure of NDI-101150 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2628486-21-3 |
|---|---|
| Purity | >98% |
| Formula | C27H27FN6O2 |
| Mol Weight | 486.5407 |
| CoA | CoA of NDI-101150 |
| Smiles: | N(C1=C2C(=C(C=C1)C=3N4C(=NC3)C=C(F)C=C4)CNC2=O)C=5N=C(CN(C)C)C(=CC5)[C@H]6CCOC6 |
|---|
KEYWORDS: buy NDI-101150 | NDI-101150 supplier | purchase | cost | manufacturer | order | distributor | buy 2628486-21-3 | 2628486-21-3 supplier