Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2669 | Purity: >98% |
 | |
| Chemical structure of Naquotinib |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | ASP-8273 |
|---|---|
| CAS No. | 1448232-80-1 |
| Purity | >98% |
| Formula | C30H42N8O3 |
| Mol Weight | 562.7063 |
| CoA | CoA of Naquotinib |
| Smiles: | CCC1=C(O[C@@H]2CCN(C2)C(=O)C=C)N=C(NC2=CC=C(C=C2)N2CCC(CC2)N2CCN(C)CC2)C(=N1)C(N)=O |
|---|
KEYWORDS: buy Naquotinib | Naquotinib supplier | purchase | cost | manufacturer | order | distributor | buy 1448232-80-1 | 1448232-80-1 supplier