Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3517 | Purity: >98% |
 | |
| Chemical structure of NAcM-OPT |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2089293-61-6 |
|---|---|
| Purity | >98% |
| Formula | C23H29Cl2N3O |
| Mol Weight | 434.402 |
| CoA | CoA of NAcM-OPT |
| Smiles: | O=C(NC1=CC=C(Cl)C(Cl)=C1)N(C2CCN(CCCC)CC2)CC3=CC=CC=C3 |
|---|
KEYWORDS: buy NAcM-OPT | NAcM-OPT supplier | purchase | cost | manufacturer | order | distributor | buy 2089293-61-6 | 2089293-61-6 supplier