Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A8500 | Purity: >98% |
 | |
| Chemical structure of N406211 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1820570-99-7 |
|---|---|
| Purity | >98% |
| Formula | C18H21NO5S |
| Mol Weight | 363.428 |
| CoA | CoA of N406211 |
| Smiles: | CC1([C@H]2CC[C@@]13CS(=O)(=O)N([C@H]3C2)C(=O)C4=CC=CC=C4C(=O)O)C |
|---|
KEYWORDS: buy N406211 | N406211 supplier | purchase | cost | manufacturer | order | distributor | buy 1820570-99-7 | 1820570-99-7 supplier