Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A691 | Purity: >98% |
 | |
| Chemical structure of MS436 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1395084-25-9 |
|---|---|
| Purity | >98% |
| Formula | C18H17N5O3S |
| Mol Weight | 383.424 |
| CoA | CoA of MS436 |
| Smiles: | CC1=CC(\N=N\C2=CC=C(C=C2)S(=O)(=O)NC2=NC=CC=C2)=C(N)C=C1O |
|---|
KEYWORDS: buy MS436 | MS436 supplier | purchase | cost | manufacturer | order | distributor | buy 1395084-25-9 | 1395084-25-9 supplier