Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3962 | Purity: >98% |
 | |
| Chemical structure of MS1943 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | MS-1943 |
|---|---|
| CAS No. | 2225938-17-8 |
| Purity | >98% |
| Formula | C42H54N8O3 |
| Mol Weight | 718.93 |
| CoA | CoA of MS1943 |
| Smiles: | CC(C)N(N=C1)C2=C1C(C(NCC3=C(C)C=C(C)NC3=O)=O)=CC(C4=CC=C(N=C4)N(CC5)CCN5CCNC(CC67C[C@H]8C[C@H](C[C@H](C8)C7)C6)=O)=C2 |
|---|
KEYWORDS: buy MS1943 | MS1943 supplier | purchase | cost | manufacturer | order | distributor | buy 2225938-17-8 | 2225938-17-8 supplier