Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A038 | Purity: >98% |
 | |
| Chemical structure of MS-275 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Entinostat |
|---|---|
| CAS No. | 209783-80-2 |
| Purity | >98% |
| Formula | C21H20N4O3 |
| Mol Weight | 376.4085 |
| CoA | CoA of MS-275 |
| Smiles: | NC1=CC=CC=C1NC(=O)C1=CC=C(CNC(=O)OCC2=CC=CN=C2)C=C1 |
|---|
KEYWORDS: buy MS-275 | MS-275 supplier | purchase | cost | manufacturer | order | distributor | buy 209783-80-2 | 209783-80-2 supplier