Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3590 | Purity: >98% |
 | |
| Chemical structure of MRS1845 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | MRS 1845 |
|---|---|
| CAS No. | 544478-19-5 |
| Purity | >98% |
| Formula | C21H22N2O6 |
| Mol Weight | 398.4092 |
| CoA | CoA of MRS1845 |
| Smiles: | O=C(C1=C(C)N(CC#C)C(C)=C(C(OC)=O)C1C2=CC=CC([N+]([O-])=O)=C2)OCC |
|---|
KEYWORDS: buy MRS1845 | MRS1845 supplier | purchase | cost | manufacturer | order | distributor | buy 544478-19-5 | 544478-19-5 supplier